C29H37N2O8S2+ — CID 89118528
3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(6-methoxy-6-oxohexyl)-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 89118528) has the molecular formula C29H37N2O8S2+ and a molecular weight of 605.76 g/mol. Its IUPAC name is 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(6-methoxy-6-oxohexyl)-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(6-methoxy-6-oxohexyl)-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89118528 |
| Molecular Formula | C29H37N2O8S2+ |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(6-methoxy-6-oxohexyl)-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | COC(=O)CCCCCC1(C)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C29H36N2O8S2/c1-29(18-9-4-7-15-28(32)37-2)25-22-24(40-39-38-33)16-17-26(25)31(20-11-21-41(34,35)36)27(29)14-8-10-19-30-23-12-5-3-6-13-23/h3,5-6,8,10,12-14,16-17,19,22H,4,7,9,11,15,18,20-21H2,1-2H3,(H2,33,34,35,36)/p+1 |
| InChIKey | JJLFZKBCXRNGEC-UHFFFAOYSA-O |
| XLogP | 6.05 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|