C39H47F6N2O8S2+ — CID 73173852
6-[4,6-difluoro-2-[5-[6-fluoro-3-methyl-1,3-bis(4-sulfobutyl)-4-(trifluoromethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid (PubChem CID 73173852) has the molecular formula C39H47F6N2O8S2+ and a molecular weight of 849.93 g/mol. Its IUPAC name is 6-[4,6-difluoro-2-[5-[6-fluoro-3-methyl-1,3-bis(4-sulfobutyl)-4-(trifluoromethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4,6-difluoro-2-[5-[6-fluoro-3-methyl-1,3-bis(4-sulfobutyl)-4-(trifluoromethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 73173852 |
| Molecular Formula | C39H47F6N2O8S2+ |
| Molecular Weight | 849.93 g/mol |
| Exact Mass | 849.27 |
| IUPAC Name | 6-[4,6-difluoro-2-[5-[6-fluoro-3-methyl-1,3-bis(4-sulfobutyl)-4-(trifluoromethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(C=CC=CC=C2N(CCCCS(=O)(=O)O)c3cc(F)cc(C(F)(F)F)c3C2(C)CCCCS(=O)(=O)O)=[N+](CCCCCC(=O)O)c2cc(F)cc(F)c21 |
| InChI | InChI=1S/C39H46F6N2O8S2/c1-37(2)32(46(18-10-5-8-16-34(48)49)31-25-27(41)23-29(42)36(31)37)14-6-4-7-15-33-38(3,17-9-12-20-56(50,51)52)35-28(39(43,44)45)22-26(40)24-30(35)47(33)19-11-13-21-57(53,54)55/h4,6-7,14-15,22-25H,5,8-13,16-21H2,1-3H3,(H2-,48,49,50,51,52,53,54,55)/p+1 |
| InChIKey | CHBIMHQRNPVSRH-UHFFFAOYSA-O |
| XLogP | 8.64 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.93 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|