C20H28F2NO2+ — CID 68810668
6-(3-butyl-5,7-difluoro-2,3-dimethylindol-1-ium-1-yl)hexanoic acid (PubChem CID 68810668) has the molecular formula C20H28F2NO2+ and a molecular weight of 352.45 g/mol. Its IUPAC name is 6-(3-butyl-5,7-difluoro-2,3-dimethylindol-1-ium-1-yl)hexanoic acid.
| Compound Name | 6-(3-butyl-5,7-difluoro-2,3-dimethylindol-1-ium-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 68810668 |
| Molecular Formula | C20H28F2NO2+ |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 6-(3-butyl-5,7-difluoro-2,3-dimethylindol-1-ium-1-yl)hexanoic acid |
| SMILES | CCCCC1(C)C(C)=[N+](CCCCCC(=O)O)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C20H27F2NO2/c1-4-5-10-20(3)14(2)23(11-8-6-7-9-18(24)25)19-16(20)12-15(21)13-17(19)22/h12-13H,4-11H2,1-3H3/p+1 |
| InChIKey | AIIITHWUJUDODQ-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|