C17H21F2NO2 — CID 172819480
6-(4,6-difluoro-2,3,3-trimethylindol-1-ium-1-yl)hexanoate (PubChem CID 172819480) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 6-(4,6-difluoro-2,3,3-trimethylindol-1-ium-1-yl)hexanoate.
| Compound Name | 6-(4,6-difluoro-2,3,3-trimethylindol-1-ium-1-yl)hexanoate |
|---|---|
| PubChem CID | 172819480 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-(4,6-difluoro-2,3,3-trimethylindol-1-ium-1-yl)hexanoate |
| SMILES | CC1=[N+](CCCCCC(=O)[O-])c2cc(F)cc(F)c2C1(C)C |
| InChI | InChI=1S/C17H21F2NO2/c1-11-17(2,3)16-13(19)9-12(18)10-14(16)20(11)8-6-4-5-7-15(21)22/h9-10H,4-8H2,1-3H3 |
| InChIKey | UAJYRIHLNYVXTA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|