C12H16FNO2 — CID 28942719
4-[(3-fluorophenyl)methyl-methylazaniumyl]butanoate (PubChem CID 28942719) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl-methylazaniumyl]butanoate.
| Compound Name | 4-[(3-fluorophenyl)methyl-methylazaniumyl]butanoate |
|---|---|
| PubChem CID | 28942719 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl-methylazaniumyl]butanoate |
| SMILES | C[NH+](CCCC(=O)[O-])Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FNO2/c1-14(7-3-6-12(15)16)9-10-4-2-5-11(13)8-10/h2,4-5,8H,3,6-7,9H2,1H3,(H,15,16) |
| InChIKey | AOBAYHPESSYXJC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |