C21H23NO2 — CID 172822368
6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hex-5-enoate (PubChem CID 172822368) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hex-5-enoate.
| Compound Name | 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hex-5-enoate |
|---|---|
| PubChem CID | 172822368 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hex-5-enoate |
| SMILES | CC1=[N+](C=CCCCC(=O)[O-])c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C21H23NO2/c1-15-21(2,3)20-17-10-7-6-9-16(17)12-13-18(20)22(15)14-8-4-5-11-19(23)24/h6-10,12-14H,4-5,11H2,1-3H3 |
| InChIKey | UJYHRRGQSGJHLA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|