C25H25ClF3N3O4S — CID 178183998
3-[5-chloro-3-ethyl-2-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-(trifluoromethyl)benzimidazol-1-yl]propane-1-sulfonate (PubChem CID 178183998) has the molecular formula C25H25ClF3N3O4S and a molecular weight of 556.01 g/mol. Its IUPAC name is 3-[5-chloro-3-ethyl-2-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-(trifluoromethyl)benzimidazol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-3-ethyl-2-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-(trifluoromethyl)benzimidazol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 178183998 |
| Molecular Formula | C25H25ClF3N3O4S |
| Molecular Weight | 556.01 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 3-[5-chloro-3-ethyl-2-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-6-(trifluoromethyl)benzimidazol-1-yl]propane-1-sulfonate |
| SMILES | CCN1C(=C/C=C/c2oc3ccccc3[n+]2CC)N(CCCS(=O)(=O)[O-])c2cc(C(F)(F)F)c(Cl)cc21 |
| InChI | InChI=1S/C25H25ClF3N3O4S/c1-3-30-21-16-18(26)17(25(27,28)29)15-20(21)32(13-8-14-37(33,34)35)23(30)11-7-12-24-31(4-2)19-9-5-6-10-22(19)36-24/h5-7,9-12,15-16H,3-4,8,13-14H2,1-2H3 |
| InChIKey | UVFPQNBGWCRWKE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 80.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.01 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|