C28H22ClKN4O7S2 — CID 59937919
potassium [(2E)-5-chloro-3-ethyl-6-isocyano-2-[(E)-3-[5-phenyl-3-(sulfonatomethyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate (PubChem CID 59937919) has the molecular formula C28H22ClKN4O7S2 and a molecular weight of 665.19 g/mol. Its IUPAC name is potassium [(2E)-5-chloro-3-ethyl-6-isocyano-2-[(E)-3-[5-phenyl-3-(sulfonatomethyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate.
| Compound Name | potassium [(2E)-5-chloro-3-ethyl-6-isocyano-2-[(E)-3-[5-phenyl-3-(sulfonatomethyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 59937919 |
| Molecular Formula | C28H22ClKN4O7S2 |
| Molecular Weight | 665.19 g/mol |
| Exact Mass | 664.03 |
| IUPAC Name | potassium [(2E)-5-chloro-3-ethyl-6-isocyano-2-[(E)-3-[5-phenyl-3-(sulfonatomethyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate |
| SMILES | [C-]#[N+]c1cc2c(cc1Cl)N(CC)/C(=C\C=C\c1oc3ccc(-c4ccccc4)cc3[n+]1CS(=O)(=O)[O-])N2CS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C28H23ClN4O7S2.K/c1-3-31-23-15-21(29)22(30-2)16-24(23)32(17-41(34,35)36)27(31)10-7-11-28-33(18-42(37,38)39)25-14-20(12-13-26(25)40-28)19-8-5-4-6-9-19;/h4-16H,3,17-18H2,1H3,(H-,34,35,36,37,38,39);/q;+1/p-1 |
| InChIKey | FKZDBRQSHGZJJS-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 142.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|