C24H25Cl3N3O+ — CID 58381930
6-chloro-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethyl-5-methyl-1,3-benzoxazol-3-ium (PubChem CID 58381930) has the molecular formula C24H25Cl3N3O+ and a molecular weight of 477.84 g/mol. Its IUPAC name is 6-chloro-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethyl-5-methyl-1,3-benzoxazol-3-ium.
| Compound Name | 6-chloro-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethyl-5-methyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 58381930 |
| Molecular Formula | C24H25Cl3N3O+ |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 6-chloro-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethyl-5-methyl-1,3-benzoxazol-3-ium |
| SMILES | CCN1C(=C/C=C/c2oc3cc(Cl)c(C)cc3[n+]2CC)N(CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C24H25Cl3N3O/c1-5-28-19-12-17(26)18(27)13-20(19)29(6-2)23(28)9-8-10-24-30(7-3)21-11-15(4)16(25)14-22(21)31-24/h8-14H,5-7H2,1-4H3/q+1 |
| InChIKey | AEZCOAQFVRSIQA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 23.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|