C25H26Cl2IN3O2 — CID 173081367
7,8-dichloro-10-ethyl-1-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-3,4-dihydro-[1,4]oxazino[4,3-a]benzimidazole iodide (PubChem CID 173081367) has the molecular formula C25H26Cl2IN3O2 and a molecular weight of 598.31 g/mol. Its IUPAC name is 7,8-dichloro-10-ethyl-1-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-3,4-dihydro-[1,4]oxazino[4,3-a]benzimidazole iodide.
| Compound Name | 7,8-dichloro-10-ethyl-1-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-3,4-dihydro-[1,4]oxazino[4,3-a]benzimidazole iodide |
|---|---|
| PubChem CID | 173081367 |
| Molecular Formula | C25H26Cl2IN3O2 |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 597.04 |
| IUPAC Name | 7,8-dichloro-10-ethyl-1-[2-(3-ethyl-5,6-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-3,4-dihydro-[1,4]oxazino[4,3-a]benzimidazole iodide |
| SMILES | CCN1C2=C(C=Cc3oc4cc(C)c(C)cc4[n+]3CC)OCCN2c2cc(Cl)c(Cl)cc21.[I-] |
| InChI | InChI=1S/C25H26Cl2N3O2.HI/c1-5-28-21-11-15(3)16(4)12-23(21)32-24(28)8-7-22-25-29(6-2)19-13-17(26)18(27)14-20(19)30(25)9-10-31-22;/h7-8,11-14H,5-6,9-10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NFOQCCAEQHPXBP-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 32.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|