C27H24NS+ — CID 74437601
1-benzyl-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium (PubChem CID 74437601) has the molecular formula C27H24NS+ and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-benzyl-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium.
| Compound Name | 1-benzyl-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 74437601 |
| Molecular Formula | C27H24NS+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-benzyl-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium |
| SMILES | C[N+]1=C(C=Cc2cccs2)C(C)(Cc2ccccc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C27H24NS/c1-27(19-20-9-4-3-5-10-20)25(17-15-22-12-8-18-29-22)28(2)24-16-14-21-11-6-7-13-23(21)26(24)27/h3-18H,19H2,1-2H3/q+1 |
| InChIKey | ICSWNVCPQFGMLK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|