C24H22NS+ — CID 25261314
1-but-2-ynyl-1,3-dimethyl-2-[(E)-2-thiophen-2-ylethenyl]benzo[e]indol-3-ium (PubChem CID 25261314) has the molecular formula C24H22NS+ and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-but-2-ynyl-1,3-dimethyl-2-[(E)-2-thiophen-2-ylethenyl]benzo[e]indol-3-ium.
| Compound Name | 1-but-2-ynyl-1,3-dimethyl-2-[(E)-2-thiophen-2-ylethenyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 25261314 |
| Molecular Formula | C24H22NS+ |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-but-2-ynyl-1,3-dimethyl-2-[(E)-2-thiophen-2-ylethenyl]benzo[e]indol-3-ium |
| SMILES | CC#CCC1(C)C(/C=C/c2cccs2)=[N+](C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C24H22NS/c1-4-5-16-24(2)22(15-13-19-10-8-17-26-19)25(3)21-14-12-18-9-6-7-11-20(18)23(21)24/h6-15,17H,16H2,1-3H3/q+1/b15-13+ |
| InChIKey | KHCGUCPERCWEFQ-FYWRMAATSA-N |
| XLogP | 6.01 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|