C39H33N2S+ — CID 175504252
N,N-diphenyl-4-[5-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]thiophen-2-yl]aniline (PubChem CID 175504252) has the molecular formula C39H33N2S+ and a molecular weight of 561.77 g/mol. Its IUPAC name is N,N-diphenyl-4-[5-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]thiophen-2-yl]aniline.
| Compound Name | N,N-diphenyl-4-[5-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]thiophen-2-yl]aniline |
|---|---|
| PubChem CID | 175504252 |
| Molecular Formula | C39H33N2S+ |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N,N-diphenyl-4-[5-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]thiophen-2-yl]aniline |
| SMILES | C[N+]1=C(C=Cc2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)s2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H33N2S/c1-39(2)37(40(3)35-25-20-28-12-10-11-17-34(28)38(35)39)27-24-33-23-26-36(42-33)29-18-21-32(22-19-29)41(30-13-6-4-7-14-30)31-15-8-5-9-16-31/h4-27H,1-3H3/q+1 |
| InChIKey | JIOUAHGRJAXTKS-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|