C32H34N2O3S2 — CID 156755928
4-[2-[(E)-2-[5-[4-(dimethylamino)phenyl]thiophen-2-yl]ethenyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 156755928) has the molecular formula C32H34N2O3S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 4-[2-[(E)-2-[5-[4-(dimethylamino)phenyl]thiophen-2-yl]ethenyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(E)-2-[5-[4-(dimethylamino)phenyl]thiophen-2-yl]ethenyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 156755928 |
| Molecular Formula | C32H34N2O3S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 4-[2-[(E)-2-[5-[4-(dimethylamino)phenyl]thiophen-2-yl]ethenyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | CN(C)c1ccc(-c2ccc(/C=C/C3=[N+](CCCCS(=O)(=O)[O-])c4ccc5ccccc5c4C3(C)C)s2)cc1 |
| InChI | InChI=1S/C32H34N2O3S2/c1-32(2)30(20-17-26-16-19-29(38-26)24-11-14-25(15-12-24)33(3)4)34(21-7-8-22-39(35,36)37)28-18-13-23-9-5-6-10-27(23)31(28)32/h5-6,9-20H,7-8,21-22H2,1-4H3 |
| InChIKey | PNFWKFBWJCXNKB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|