C36H46N2O3S2 — CID 23642833
4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 23642833) has the molecular formula C36H46N2O3S2 and a molecular weight of 618.91 g/mol. Its IUPAC name is 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 23642833 |
| Molecular Formula | C36H46N2O3S2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(/C=C/C3=[N+](CCCCS(=O)(=O)[O-])c4ccccc4C3(C)C)s2)cc1 |
| InChI | InChI=1S/C36H46N2O3S2/c1-5-7-25-37(26-8-6-2)30-18-15-29(16-19-30)17-20-31-21-22-32(42-31)23-24-35-36(3,4)33-13-9-10-14-34(33)38(35)27-11-12-28-43(39,40)41/h9-10,13-24H,5-8,11-12,25-28H2,1-4H3 |
| InChIKey | JKFYKDCNJNFHBD-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|