C33H41N2O4S2+ — CID 23642838
4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 23642838) has the molecular formula C33H41N2O4S2+ and a molecular weight of 593.84 g/mol. Its IUPAC name is 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 23642838 |
| Molecular Formula | C33H41N2O4S2+ |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 4-[2-[(E)-2-[5-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(/C=C/c3oc4ccccc4[n+]3CCCCS(=O)(=O)O)s2)cc1 |
| InChI | InChI=1S/C33H40N2O4S2/c1-3-5-23-34(24-6-4-2)28-16-13-27(14-17-28)15-18-29-19-20-30(40-29)21-22-33-35(25-9-10-26-41(36,37)38)31-11-7-8-12-32(31)39-33/h7-8,11-22H,3-6,9-10,23-26H2,1-2H3/p+1 |
| InChIKey | RJXZTMQSJPSLCI-UHFFFAOYSA-O |
| XLogP | 8.20 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|