C57H72N3+ — CID 177403971
N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[1-butyl-6-[(E)-2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]pyridin-1-ium-2-yl]ethenyl]phenyl]ethenyl]aniline (PubChem CID 177403971) has the molecular formula C57H72N3+ and a molecular weight of 799.22 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[1-butyl-6-[(E)-2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]pyridin-1-ium-2-yl]ethenyl]phenyl]ethenyl]aniline.
| Compound Name | N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[1-butyl-6-[(E)-2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]pyridin-1-ium-2-yl]ethenyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 177403971 |
| Molecular Formula | C57H72N3+ |
| Molecular Weight | 799.22 g/mol |
| Exact Mass | 798.57 |
| IUPAC Name | N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[1-butyl-6-[(E)-2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]pyridin-1-ium-2-yl]ethenyl]phenyl]ethenyl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(/C=C/c3cccc(/C=C/c4ccc(/C=C/c5ccc(N(CCCC)CCCC)cc5)cc4)[n+]3CCCC)cc2)cc1 |
| InChI | InChI=1S/C57H72N3/c1-6-11-43-58(44-12-7-2)54-37-31-52(32-38-54)29-23-48-19-25-50(26-20-48)35-41-56-17-16-18-57(60(56)47-15-10-5)42-36-51-27-21-49(22-28-51)24-30-53-33-39-55(40-34-53)59(45-13-8-3)46-14-9-4/h16-42H,6-15,43-47H2,1-5H3/q+1 |
| InChIKey | AENBTIHOBFNMEF-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.22 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|