C32H32F2N2O2S — CID 76563698
2-cyano-3-[4-[2-[5-[2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-2,6-difluorophenyl]prop-2-enoic acid (PubChem CID 76563698) has the molecular formula C32H32F2N2O2S and a molecular weight of 546.68 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-[5-[2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-2,6-difluorophenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[2-[5-[2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-2,6-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76563698 |
| Molecular Formula | C32H32F2N2O2S |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 2-cyano-3-[4-[2-[5-[2-[4-(dibutylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]-2,6-difluorophenyl]prop-2-enoic acid |
| SMILES | CCCCN(CCCC)c1ccc(C=Cc2ccc(C=Cc3cc(F)c(C=C(C#N)C(=O)O)c(F)c3)s2)cc1 |
| InChI | InChI=1S/C32H32F2N2O2S/c1-3-5-17-36(18-6-4-2)26-11-7-23(8-12-26)9-13-27-15-16-28(39-27)14-10-24-19-30(33)29(31(34)20-24)21-25(22-35)32(37)38/h7-16,19-21H,3-6,17-18H2,1-2H3,(H,37,38) |
| InChIKey | CTFHAHXPZXWBNZ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|