C34H34N2O2S — CID 76563703
5-[5-[2-[6-(dibutylamino)anthracen-2-yl]ethenyl]thiophen-2-yl]-2-isocyanopenta-2,4-dienoic acid (PubChem CID 76563703) has the molecular formula C34H34N2O2S and a molecular weight of 534.73 g/mol. Its IUPAC name is 5-[5-[2-[6-(dibutylamino)anthracen-2-yl]ethenyl]thiophen-2-yl]-2-isocyanopenta-2,4-dienoic acid.
| Compound Name | 5-[5-[2-[6-(dibutylamino)anthracen-2-yl]ethenyl]thiophen-2-yl]-2-isocyanopenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 76563703 |
| Molecular Formula | C34H34N2O2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 5-[5-[2-[6-(dibutylamino)anthracen-2-yl]ethenyl]thiophen-2-yl]-2-isocyanopenta-2,4-dienoic acid |
| SMILES | [C-]#[N+]C(=CC=Cc1ccc(C=Cc2ccc3cc4cc(N(CCCC)CCCC)ccc4cc3c2)s1)C(=O)O |
| InChI | InChI=1S/C34H34N2O2S/c1-4-6-19-36(20-7-5-2)30-15-14-27-22-28-21-25(11-13-26(28)23-29(27)24-30)12-16-32-18-17-31(39-32)9-8-10-33(35-3)34(37)38/h8-18,21-24H,4-7,19-20H2,1-2H3,(H,37,38) |
| InChIKey | CDHTWJGVOMKJSC-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|