C31H41N2O4+ — CID 177489721
(2R,3S,4R)-2-[[4-[(E)-2-[6-(dibutylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]methyl]-5-methoxyoxolane-3,4-diol (PubChem CID 177489721) has the molecular formula C31H41N2O4+ and a molecular weight of 505.68 g/mol. Its IUPAC name is (2R,3S,4R)-2-[[4-[(E)-2-[6-(dibutylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]methyl]-5-methoxyoxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-[[4-[(E)-2-[6-(dibutylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]methyl]-5-methoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 177489721 |
| Molecular Formula | C31H41N2O4+ |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | (2R,3S,4R)-2-[[4-[(E)-2-[6-(dibutylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]methyl]-5-methoxyoxolane-3,4-diol |
| SMILES | CCCCN(CCCC)c1ccc2cc(/C=C/c3cc[n+](C[C@H]4OC(OC)[C@H](O)[C@@H]4O)cc3)ccc2c1 |
| InChI | InChI=1S/C31H41N2O4/c1-4-6-16-33(17-7-5-2)27-13-12-25-20-24(10-11-26(25)21-27)9-8-23-14-18-32(19-15-23)22-28-29(34)30(35)31(36-3)37-28/h8-15,18-21,28-31,34-35H,4-7,16-17,22H2,1-3H3/q+1/t28-,29-,30-,31?/m1/s1 |
| InChIKey | URWZITZCMNIJTI-ARRFSJQMSA-N |
| XLogP | 4.80 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|