C39H48N2O2 — CID 58239561
(Z)-3-[4-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]phenyl]-2-isocyanoprop-2-enoic acid (PubChem CID 58239561) has the molecular formula C39H48N2O2 and a molecular weight of 576.83 g/mol. Its IUPAC name is (Z)-3-[4-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]phenyl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]phenyl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 58239561 |
| Molecular Formula | C39H48N2O2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | (Z)-3-[4-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]phenyl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc3c(c2)C(CCCC)(CCCC)c2cc(N(CCCC)CCCC)ccc2-3)cc1)C(=O)O |
| InChI | InChI=1S/C39H48N2O2/c1-6-10-22-39(23-11-7-2)35-27-31(30-16-14-29(15-17-30)26-37(40-5)38(42)43)18-20-33(35)34-21-19-32(28-36(34)39)41(24-12-8-3)25-13-9-4/h14-21,26-28H,6-13,22-25H2,1-4H3,(H,42,43)/b37-26- |
| InChIKey | HUPBUDGXHPVECA-UOZKZNBHSA-N |
| XLogP | 10.75 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|