About 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid
2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid (PubChem CID 70975594) has the molecular formula C33H44N2O2
and a molecular weight of 500.73 g/mol. Its IUPAC name is 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid |
| PubChem CID | 70975594 |
| Molecular Formula | C33H44N2O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)C(CCCC)(CCCC)c1cc(C=C(C#N)C(=O)O)ccc1-2 |
| InChI | InChI=1S/C33H44N2O2/c1-5-9-17-33(18-10-6-2)30-22-25(21-26(24-34)32(36)37)13-15-28(30)29-16-14-27(23-31(29)33)35(19-11-7-3)20-12-8-4/h13-16,21-23H,5-12,17-20H2,1-4H3,(H,36,37) |
| InChIKey | XZAHAFSFRHNWFI-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid?
The IUPAC name of 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid (CID 70975594) is 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid.
What is the SMILES notation for 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid?
The canonical SMILES for 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid is CCCCN(CCCC)c1ccc2c(c1)C(CCCC)(CCCC)c1cc(C=C(C#N)C(=O)O)ccc1-2.
What is the InChIKey of 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid?
The InChIKey is XZAHAFSFRHNWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H44N2O2/c1-5-9-17-33(18-10-6-2)30-22-25(21-26(24-34)32(36)37)13-15-28(30)29-16-14-27(23-31(29)33)35(19-11-7-3)20-12-8-4/h13-16,21-23H,5-12,17-20H2,1-4H3,(H,36,37).
What are the key properties of 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid?
2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid has a molecular weight of 500.73 g/mol, XLogP of 8.73, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-[9,9-dibutyl-7-(dibutylamino)fluoren-2-yl]prop-2-enoic acid is sourced from PubChem (CID 70975594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).