C38H38N2O4 — CID 139577698
(Z)-2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dibutylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 139577698) has the molecular formula C38H38N2O4 and a molecular weight of 586.73 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dibutylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dibutylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139577698 |
| Molecular Formula | C38H38N2O4 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dibutylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCN(CCCC)c1ccc2c(C)c(/C=C/c3ccc(/C=C/c4ccc(/C=C(/C#N)C(=O)O)cc4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C38H38N2O4/c1-4-6-22-40(23-7-5-2)33-19-21-34-27(3)35(38(43)44-36(34)25-33)20-18-30-12-10-28(11-13-30)8-9-29-14-16-31(17-15-29)24-32(26-39)37(41)42/h8-21,24-25H,4-7,22-23H2,1-3H3,(H,41,42)/b9-8+,20-18+,32-24- |
| InChIKey | LJOISHBEQAJZOA-BOKSUOHDSA-N |
| XLogP | 8.84 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|