C31H27NO4 — CID 146187399
(E)-3-[4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 146187399) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146187399 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (E)-3-[4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1c(/C=C/c2ccc(/C=C/c3ccc(/C=C/C(=O)O)cc3)cc2)c(=O)oc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C31H27NO4/c1-21-27-18-16-26(32(2)3)20-29(27)36-31(35)28(21)17-14-24-10-6-22(7-11-24)4-5-23-8-12-25(13-9-23)15-19-30(33)34/h4-20H,1-3H3,(H,33,34)/b5-4+,17-14+,19-15+ |
| InChIKey | FECQBHXUDNUGGT-VXHSQHJGSA-N |
| XLogP | 6.61 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|