C26H20FNO5 — CID 118737796
(E)-3-[4-[[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]-methylamino]phenyl]prop-2-enoic acid (PubChem CID 118737796) has the molecular formula C26H20FNO5 and a molecular weight of 445.45 g/mol. Its IUPAC name is (E)-3-[4-[[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]-methylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]-methylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118737796 |
| Molecular Formula | C26H20FNO5 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (E)-3-[4-[[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]-methylamino]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(F)ccc1-c1c(N(C)c2ccc(/C=C/C(=O)O)cc2)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C26H20FNO5/c1-15-13-17(27)6-10-20(15)24-25(21-11-9-19(29)14-22(21)33-26(24)32)28(2)18-7-3-16(4-8-18)5-12-23(30)31/h3-14,29H,1-2H3,(H,30,31)/b12-5+ |
| InChIKey | MXKFWFABWNUKCB-LFYBBSHMSA-N |
| XLogP | 5.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|