C25H18O6 — CID 46916593
(E)-3-[4-[[7-hydroxy-3-(4-hydroxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 46916593) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is (E)-3-[4-[[7-hydroxy-3-(4-hydroxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[7-hydroxy-3-(4-hydroxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 46916593 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (E)-3-[4-[[7-hydroxy-3-(4-hydroxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Cc2c(-c3ccc(O)cc3)c(=O)oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C25H18O6/c26-18-8-6-17(7-9-18)24-21(20-11-10-19(27)14-22(20)31-25(24)30)13-16-3-1-15(2-4-16)5-12-23(28)29/h1-12,14,26-27H,13H2,(H,28,29)/b12-5+ |
| InChIKey | CFEYQKRTRNPKOO-LFYBBSHMSA-N |
| XLogP | 4.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|