C26H20O6 — CID 118737782
(E)-3-[4-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 118737782) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is (E)-3-[4-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118737782 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (E)-3-[4-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cccc(-c2c(Cc3ccc(/C=C/C(=O)O)cc3)c3ccc(O)cc3oc2=O)c1 |
| InChI | InChI=1S/C26H20O6/c1-31-20-4-2-3-18(14-20)25-22(21-11-10-19(27)15-23(21)32-26(25)30)13-17-7-5-16(6-8-17)9-12-24(28)29/h2-12,14-15,27H,13H2,1H3,(H,28,29)/b12-9+ |
| InChIKey | YSRBGDXECCKJDL-FMIVXFBMSA-N |
| XLogP | 4.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|