C25H16ClFO5 — CID 139356947
(E)-3-[4-[[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 139356947) has the molecular formula C25H16ClFO5 and a molecular weight of 450.85 g/mol. Its IUPAC name is (E)-3-[4-[[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139356947 |
| Molecular Formula | C25H16ClFO5 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (E)-3-[4-[[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Cc2c(-c3ccc(F)c(Cl)c3)c(=O)oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C25H16ClFO5/c26-20-12-16(6-9-21(20)27)24-19(18-8-7-17(28)13-22(18)32-25(24)31)11-15-3-1-14(2-4-15)5-10-23(29)30/h1-10,12-13,28H,11H2,(H,29,30)/b10-5+ |
| InChIKey | UCGWYUBMXMZTNX-BJMVGYQFSA-N |
| XLogP | 5.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|