C25H17FO5 — CID 118737792
(E)-3-[4-[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]phenyl]prop-2-enoic acid (PubChem CID 118737792) has the molecular formula C25H17FO5 and a molecular weight of 416.40 g/mol. Its IUPAC name is (E)-3-[4-[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118737792 |
| Molecular Formula | C25H17FO5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (E)-3-[4-[3-(4-fluoro-2-methylphenyl)-7-hydroxy-2-oxochromen-4-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(F)ccc1-c1c(-c2ccc(/C=C/C(=O)O)cc2)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C25H17FO5/c1-14-12-17(26)7-9-19(14)24-23(16-5-2-15(3-6-16)4-11-22(28)29)20-10-8-18(27)13-21(20)31-25(24)30/h2-13,27H,1H3,(H,28,29)/b11-4+ |
| InChIKey | QVBLSFKMAWYOJB-NYYWCZLTSA-N |
| XLogP | 5.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|