C25H18O5S — CID 158968057
(E)-3-[4-[6-hydroxy-2-(2-hydroxy-6-methylbenzoyl)-1-benzothiophen-3-yl]phenyl]prop-2-enoic acid (PubChem CID 158968057) has the molecular formula C25H18O5S and a molecular weight of 430.48 g/mol. Its IUPAC name is (E)-3-[4-[6-hydroxy-2-(2-hydroxy-6-methylbenzoyl)-1-benzothiophen-3-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[6-hydroxy-2-(2-hydroxy-6-methylbenzoyl)-1-benzothiophen-3-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 158968057 |
| Molecular Formula | C25H18O5S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (E)-3-[4-[6-hydroxy-2-(2-hydroxy-6-methylbenzoyl)-1-benzothiophen-3-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(O)c1C(=O)c1sc2cc(O)ccc2c1-c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C25H18O5S/c1-14-3-2-4-19(27)22(14)24(30)25-23(18-11-10-17(26)13-20(18)31-25)16-8-5-15(6-9-16)7-12-21(28)29/h2-13,26-27H,1H3,(H,28,29)/b12-7+ |
| InChIKey | ARLMFYCJBKAXFF-KPKJPENVSA-N |
| XLogP | 5.62 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|