C27H22O3S — CID 161188174
(E)-4-[4-[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]but-3-en-2-one (PubChem CID 161188174) has the molecular formula C27H22O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is (E)-4-[4-[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 161188174 |
| Molecular Formula | C27H22O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (E)-4-[4-[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(-c2c(C(=O)c3c(C)cccc3C)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C27H22O3S/c1-16-5-4-6-17(2)24(16)26(30)27-25(22-14-13-21(29)15-23(22)31-27)20-11-9-19(10-12-20)8-7-18(3)28/h4-15,29H,1-3H3/b8-7+ |
| InChIKey | QSFKYSLCCWJNDZ-BQYQJAHWSA-N |
| XLogP | 6.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|