C27H22O5S — CID 129224171
methyl (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 129224171) has the molecular formula C27H22O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 129224171 |
| Molecular Formula | C27H22O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | methyl (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(Oc2c(C(=O)c3c(C)cccc3C)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C27H22O5S/c1-16-5-4-6-17(2)24(16)25(30)27-26(21-13-10-19(28)15-22(21)33-27)32-20-11-7-18(8-12-20)9-14-23(29)31-3/h4-15,28H,1-3H3/b14-9+ |
| InChIKey | FAELCXPXYSPEJB-NTEUORMPSA-N |
| XLogP | 6.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|