C24H17FO4S — CID 78324256
methyl (E)-3-[4-[[2-(4-fluorophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 78324256) has the molecular formula C24H17FO4S and a molecular weight of 420.46 g/mol. Its IUPAC name is methyl (E)-3-[4-[[2-(4-fluorophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[2-(4-fluorophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 78324256 |
| Molecular Formula | C24H17FO4S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | methyl (E)-3-[4-[[2-(4-fluorophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(Oc2c(-c3ccc(F)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H17FO4S/c1-28-22(27)13-4-15-2-10-19(11-3-15)29-23-20-12-9-18(26)14-21(20)30-24(23)16-5-7-17(25)8-6-16/h2-14,26H,1H3/b13-4+ |
| InChIKey | YWWWSZQEAFDWGO-YIXHJXPBSA-N |
| XLogP | 6.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|