C24H17FO5S — CID 118585686
(E)-3-[4-[[2-[2-(fluoromethoxy)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 118585686) has the molecular formula C24H17FO5S and a molecular weight of 436.46 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-(fluoromethoxy)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[2-(fluoromethoxy)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118585686 |
| Molecular Formula | C24H17FO5S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (E)-3-[4-[[2-[2-(fluoromethoxy)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Oc2c(-c3ccccc3OCF)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H17FO5S/c25-14-29-20-4-2-1-3-18(20)24-23(19-11-8-16(26)13-21(19)31-24)30-17-9-5-15(6-10-17)7-12-22(27)28/h1-13,26H,14H2,(H,27,28)/b12-7+ |
| InChIKey | GWOUISNPFGKHGV-KPKJPENVSA-N |
| XLogP | 6.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|