C27H24O3S — CID 90372224
(E)-4-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]but-3-en-2-one (PubChem CID 90372224) has the molecular formula C27H24O3S and a molecular weight of 428.55 g/mol. Its IUPAC name is (E)-4-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 90372224 |
| Molecular Formula | C27H24O3S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (E)-4-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(Oc2c(-c3ccccc3C(C)C)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C27H24O3S/c1-17(2)22-6-4-5-7-23(22)27-26(24-15-12-20(29)16-25(24)31-27)30-21-13-10-19(11-14-21)9-8-18(3)28/h4-17,29H,1-3H3/b9-8+ |
| InChIKey | HWZFVRAQMSKMQS-CMDGGOBGSA-N |
| XLogP | 7.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|