C27H24O5S — CID 118574954
(E)-3-[4-[[6-hydroxy-2-(4-methoxy-2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 118574954) has the molecular formula C27H24O5S and a molecular weight of 460.55 g/mol. Its IUPAC name is (E)-3-[4-[[6-hydroxy-2-(4-methoxy-2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[6-hydroxy-2-(4-methoxy-2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118574954 |
| Molecular Formula | C27H24O5S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (E)-3-[4-[[6-hydroxy-2-(4-methoxy-2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(/C=C/C(=O)O)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C27H24O5S/c1-16(2)23-15-20(31-3)10-12-21(23)27-26(22-11-7-18(28)14-24(22)33-27)32-19-8-4-17(5-9-19)6-13-25(29)30/h4-16,28H,1-3H3,(H,29,30)/b13-6+ |
| InChIKey | WJMQFSQRHMFVFK-AWNIVKPZSA-N |
| XLogP | 7.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|