C26H23NO3S — CID 90372172
(E)-3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]amino]phenyl]prop-2-enoic acid (PubChem CID 90372172) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is (E)-3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90372172 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (E)-3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]amino]phenyl]prop-2-enoic acid |
| SMILES | CC(C)c1ccccc1-c1sc2cc(O)ccc2c1Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C26H23NO3S/c1-16(2)20-5-3-4-6-21(20)26-25(22-13-12-19(28)15-23(22)31-26)27-18-10-7-17(8-11-18)9-14-24(29)30/h3-16,27-28H,1-2H3,(H,29,30)/b14-9+ |
| InChIKey | YRTUCHBNNALTBG-NTEUORMPSA-N |
| XLogP | 7.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|