C31H31NO5S — CID 123262733
3-[4-[[6-(2-amino-3-methylbutanoyl)oxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 123262733) has the molecular formula C31H31NO5S and a molecular weight of 529.66 g/mol. Its IUPAC name is 3-[4-[[6-(2-amino-3-methylbutanoyl)oxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[6-(2-amino-3-methylbutanoyl)oxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123262733 |
| Molecular Formula | C31H31NO5S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3-[4-[[6-(2-amino-3-methylbutanoyl)oxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | CC(C)c1ccccc1-c1sc2cc(OC(=O)C(N)C(C)C)ccc2c1Oc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C31H31NO5S/c1-18(2)23-7-5-6-8-24(23)30-29(36-21-12-9-20(10-13-21)11-16-27(33)34)25-15-14-22(17-26(25)38-30)37-31(35)28(32)19(3)4/h5-19,28H,32H2,1-4H3,(H,33,34) |
| InChIKey | YVJZSPNXAIQNBY-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|