C29H25NO4S — CID 123265198
tert-butyl (E)-3-[4-[[2-(2-isocyanophenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 123265198) has the molecular formula C29H25NO4S and a molecular weight of 483.59 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[[2-(2-isocyanophenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[[2-(2-isocyanophenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123265198 |
| Molecular Formula | C29H25NO4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | tert-butyl (E)-3-[4-[[2-(2-isocyanophenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | [C-]#[N+]c1ccccc1-c1sc2cc(OC)ccc2c1Oc1ccc(/C=C/C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H25NO4S/c1-29(2,3)34-26(31)17-12-19-10-13-20(14-11-19)33-27-23-16-15-21(32-5)18-25(23)35-28(27)22-8-6-7-9-24(22)30-4/h6-18H,1-3,5H3/b17-12+ |
| InChIKey | PBNVONZIFZGOMP-SFQUDFHCSA-N |
| XLogP | 8.27 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|