C30H30O4S — CID 90343094
tert-butyl (E)-3-[4-[[2-(3,5-dimethylphenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 90343094) has the molecular formula C30H30O4S and a molecular weight of 486.63 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[[2-(3,5-dimethylphenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[[2-(3,5-dimethylphenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90343094 |
| Molecular Formula | C30H30O4S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | tert-butyl (E)-3-[4-[[2-(3,5-dimethylphenyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/C(=O)OC(C)(C)C)cc3)c(-c3cc(C)cc(C)c3)sc2c1 |
| InChI | InChI=1S/C30H30O4S/c1-19-15-20(2)17-22(16-19)29-28(25-13-12-24(32-6)18-26(25)35-29)33-23-10-7-21(8-11-23)9-14-27(31)34-30(3,4)5/h7-18H,1-6H3/b14-9+ |
| InChIKey | UHZONXSZBXEQIY-NTEUORMPSA-N |
| XLogP | 8.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|