C24H20O4S — CID 135278449
2-[4-[[6-methoxy-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenoxy]acetaldehyde (PubChem CID 135278449) has the molecular formula C24H20O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[4-[[6-methoxy-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenoxy]acetaldehyde.
| Compound Name | 2-[4-[[6-methoxy-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 135278449 |
| Molecular Formula | C24H20O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[4-[[6-methoxy-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenoxy]acetaldehyde |
| SMILES | COc1ccc2c(Oc3ccc(OCC=O)cc3)c(-c3ccc(C)cc3)sc2c1 |
| InChI | InChI=1S/C24H20O4S/c1-16-3-5-17(6-4-16)24-23(21-12-11-20(26-2)15-22(21)29-24)28-19-9-7-18(8-10-19)27-14-13-25/h3-13,15H,14H2,1-2H3 |
| InChIKey | IJZCCMCIBMAACV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|