C22H18O2S — CID 59943699
4-[[6-methyl-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenol (PubChem CID 59943699) has the molecular formula C22H18O2S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-[[6-methyl-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenol.
| Compound Name | 4-[[6-methyl-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenol |
|---|---|
| PubChem CID | 59943699 |
| Molecular Formula | C22H18O2S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[[6-methyl-2-(4-methylphenyl)-1-benzothiophen-3-yl]oxy]phenol |
| SMILES | Cc1ccc(-c2sc3cc(C)ccc3c2Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H18O2S/c1-14-3-6-16(7-4-14)22-21(24-18-10-8-17(23)9-11-18)19-12-5-15(2)13-20(19)25-22/h3-13,23H,1-2H3 |
| InChIKey | AEQDQHVXRBTROK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |