C27H28ClNO4S2 — CID 21253234
2-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxysulfanyl)phenoxy]-1-benzothiophen-6-ol;hydrochloride (PubChem CID 21253234) has the molecular formula C27H28ClNO4S2 and a molecular weight of 530.11 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxysulfanyl)phenoxy]-1-benzothiophen-6-ol;hydrochloride.
| Compound Name | 2-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxysulfanyl)phenoxy]-1-benzothiophen-6-ol;hydrochloride |
|---|---|
| PubChem CID | 21253234 |
| Molecular Formula | C27H28ClNO4S2 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxysulfanyl)phenoxy]-1-benzothiophen-6-ol;hydrochloride |
| SMILES | Cl.Oc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(SOCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H27NO4S2.ClH/c29-20-6-4-19(5-7-20)27-26(24-13-8-21(30)18-25(24)33-27)32-22-9-11-23(12-10-22)34-31-17-16-28-14-2-1-3-15-28;/h4-13,18,29-30H,1-3,14-17H2;1H |
| InChIKey | LAOFZHJDJCGHPY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|