C28H29NO4S2 — CID 21253265
1-[2-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]sulfanyloxyethyl]pyrrolidine (PubChem CID 21253265) has the molecular formula C28H29NO4S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 1-[2-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]sulfanyloxyethyl]pyrrolidine.
| Compound Name | 1-[2-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]sulfanyloxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 21253265 |
| Molecular Formula | C28H29NO4S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-[2-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]sulfanyloxyethyl]pyrrolidine |
| SMILES | COc1ccc(-c2sc3cc(OC)ccc3c2Oc2ccc(SOCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO4S2/c1-30-21-7-5-20(6-8-21)28-27(25-14-11-23(31-2)19-26(25)34-28)33-22-9-12-24(13-10-22)35-32-18-17-29-15-3-4-16-29/h5-14,19H,3-4,15-18H2,1-2H3 |
| InChIKey | JBBJHIMNBKOCNL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|