C30H35NO4S — CID 163670557
(2E,4E)-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-2-methyl-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one (PubChem CID 163670557) has the molecular formula C30H35NO4S and a molecular weight of 505.68 g/mol. Its IUPAC name is (2E,4E)-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-2-methyl-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-2-methyl-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 163670557 |
| Molecular Formula | C30H35NO4S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (2E,4E)-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-2-methyl-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one |
| SMILES | COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)/C(C)=C/C=C(\C)OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C30H35NO4S/c1-21(8-9-22(2)35-19-18-31-16-6-5-7-17-31)29(32)28-26-15-14-25(34-4)20-27(26)36-30(28)23-10-12-24(33-3)13-11-23/h8-15,20H,5-7,16-19H2,1-4H3/b21-8+,22-9+ |
| InChIKey | JCDUEYBFRFGFQS-QFNQXPJWSA-N |
| XLogP | 7.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|