C28H28N2O2S — CID 22462766
[2-(4-aminophenyl)-6-methoxy-1-benzothiophen-3-yl]-[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methanone (PubChem CID 22462766) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is [2-(4-aminophenyl)-6-methoxy-1-benzothiophen-3-yl]-[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methanone.
| Compound Name | [2-(4-aminophenyl)-6-methoxy-1-benzothiophen-3-yl]-[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 22462766 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [2-(4-aminophenyl)-6-methoxy-1-benzothiophen-3-yl]-[3-methyl-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
| SMILES | COc1ccc2c(C(=O)c3ccc(CN4CCCC4)c(C)c3)c(-c3ccc(N)cc3)sc2c1 |
| InChI | InChI=1S/C28H28N2O2S/c1-18-15-20(5-6-21(18)17-30-13-3-4-14-30)27(31)26-24-12-11-23(32-2)16-25(24)33-28(26)19-7-9-22(29)10-8-19/h5-12,15-16H,3-4,13-14,17,29H2,1-2H3 |
| InChIKey | MPPLBLDPXXCCLJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|