C29H31NO4S — CID 89269734
(2E,4E)-2-ethenyl-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one (PubChem CID 89269734) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-2-ethenyl-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 89269734 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (2E,4E)-2-ethenyl-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-(2-piperidin-1-ylethoxy)hexa-2,4-dien-1-one |
| SMILES | C=C/C(=C\C=C(/C)OCCN1CCCCC1)C(=O)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C29H31NO4S/c1-3-21(8-7-20(2)34-18-17-30-15-5-4-6-16-30)28(33)27-25-14-13-24(32)19-26(25)35-29(27)22-9-11-23(31)12-10-22/h3,7-14,19,31-32H,1,4-6,15-18H2,2H3/b20-7+,21-8+ |
| InChIKey | ZAVZDUPBYFQIKE-BPYXDGQXSA-N |
| XLogP | 6.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|