C27H26FNO4S — CID 56961799
3-[4-[2-(4-fluoropiperidin-1-yl)ethoxy]phenoxy]-2-(4-hydroxyphenyl)-1-benzothiophen-6-ol (PubChem CID 56961799) has the molecular formula C27H26FNO4S and a molecular weight of 479.57 g/mol. Its IUPAC name is 3-[4-[2-(4-fluoropiperidin-1-yl)ethoxy]phenoxy]-2-(4-hydroxyphenyl)-1-benzothiophen-6-ol.
| Compound Name | 3-[4-[2-(4-fluoropiperidin-1-yl)ethoxy]phenoxy]-2-(4-hydroxyphenyl)-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 56961799 |
| Molecular Formula | C27H26FNO4S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[4-[2-(4-fluoropiperidin-1-yl)ethoxy]phenoxy]-2-(4-hydroxyphenyl)-1-benzothiophen-6-ol |
| SMILES | Oc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(OCCN3CCC(F)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H26FNO4S/c28-19-11-13-29(14-12-19)15-16-32-22-6-8-23(9-7-22)33-26-24-10-5-21(31)17-25(24)34-27(26)18-1-3-20(30)4-2-18/h1-10,17,19,30-31H,11-16H2 |
| InChIKey | KSCBBOIVERYNOO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |