C30H33BrN2O5S — CID 135261867
2-(4-bromophenyl)-3-[4-[2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethoxy]phenoxy]-1-benzothiophen-6-ol (PubChem CID 135261867) has the molecular formula C30H33BrN2O5S and a molecular weight of 613.57 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-[4-[2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethoxy]phenoxy]-1-benzothiophen-6-ol.
| Compound Name | 2-(4-bromophenyl)-3-[4-[2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethoxy]phenoxy]-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 135261867 |
| Molecular Formula | C30H33BrN2O5S |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 2-(4-bromophenyl)-3-[4-[2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethoxy]phenoxy]-1-benzothiophen-6-ol |
| SMILES | COC(CN1CCN(CCOc2ccc(Oc3c(-c4ccc(Br)cc4)sc4cc(O)ccc34)cc2)CC1)OC |
| InChI | InChI=1S/C30H33BrN2O5S/c1-35-28(36-2)20-33-15-13-32(14-16-33)17-18-37-24-8-10-25(11-9-24)38-29-26-12-7-23(34)19-27(26)39-30(29)21-3-5-22(31)6-4-21/h3-12,19,28,34H,13-18,20H2,1-2H3 |
| InChIKey | PGMMSAOVURREAQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|