C37H35BrN2O5S — CID 142408010
4-[4-[5-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]pentyl]piperazin-1-yl]phthalaldehyde (PubChem CID 142408010) has the molecular formula C37H35BrN2O5S and a molecular weight of 699.67 g/mol. Its IUPAC name is 4-[4-[5-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]pentyl]piperazin-1-yl]phthalaldehyde.
| Compound Name | 4-[4-[5-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]pentyl]piperazin-1-yl]phthalaldehyde |
|---|---|
| PubChem CID | 142408010 |
| Molecular Formula | C37H35BrN2O5S |
| Molecular Weight | 699.67 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | 4-[4-[5-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]pentyl]piperazin-1-yl]phthalaldehyde |
| SMILES | O=Cc1ccc(N2CCN(CCCCCOc3ccc(Oc4c(-c5ccc(Br)cc5)sc5cc(O)ccc45)cc3)CC2)cc1C=O |
| InChI | InChI=1S/C37H35BrN2O5S/c38-29-7-4-26(5-8-29)37-36(34-15-10-31(43)23-35(34)46-37)45-33-13-11-32(12-14-33)44-21-3-1-2-16-39-17-19-40(20-18-39)30-9-6-27(24-41)28(22-30)25-42/h4-15,22-25,43H,1-3,16-21H2 |
| InChIKey | ZVJRQLNSQUOZFI-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.67 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|